C11H17ClF2NO3P — CID 21088749
4-[diethoxyphosphoryl(difluoro)methyl]aniline;hydrochloride (PubChem CID 21088749) has the molecular formula C11H17ClF2NO3P and a molecular weight of 315.68 g/mol. Its IUPAC name is 4-[diethoxyphosphoryl(difluoro)methyl]aniline;hydrochloride.
| Compound Name | 4-[diethoxyphosphoryl(difluoro)methyl]aniline;hydrochloride |
|---|---|
| PubChem CID | 21088749 |
| Molecular Formula | C11H17ClF2NO3P |
| Molecular Weight | 315.68 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 4-[diethoxyphosphoryl(difluoro)methyl]aniline;hydrochloride |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C11H16F2NO3P.ClH/c1-3-16-18(15,17-4-2)11(12,13)9-5-7-10(14)8-6-9;/h5-8H,3-4,14H2,1-2H3;1H |
| InChIKey | PWSKVWISZSYRMP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.68 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|