C18H25F2O5P — CID 74007963
tert-butyl 3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]prop-2-enoate (PubChem CID 74007963) has the molecular formula C18H25F2O5P and a molecular weight of 390.36 g/mol. Its IUPAC name is tert-butyl 3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]prop-2-enoate.
| Compound Name | tert-butyl 3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 74007963 |
| Molecular Formula | C18H25F2O5P |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | tert-butyl 3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]prop-2-enoate |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1ccc(C=CC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H25F2O5P/c1-6-23-26(22,24-7-2)18(19,20)15-11-8-14(9-12-15)10-13-16(21)25-17(3,4)5/h8-13H,6-7H2,1-5H3 |
| InChIKey | KOMDGVPBEJDVCH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|