C22H33F2O4P — CID 10048323
(E)-4-(3,5-ditert-butylphenyl)-1-diethoxyphosphoryl-1,1-difluorobut-3-en-2-one (PubChem CID 10048323) has the molecular formula C22H33F2O4P and a molecular weight of 430.47 g/mol. Its IUPAC name is (E)-4-(3,5-ditert-butylphenyl)-1-diethoxyphosphoryl-1,1-difluorobut-3-en-2-one.
| Compound Name | (E)-4-(3,5-ditert-butylphenyl)-1-diethoxyphosphoryl-1,1-difluorobut-3-en-2-one |
|---|---|
| PubChem CID | 10048323 |
| Molecular Formula | C22H33F2O4P |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (E)-4-(3,5-ditert-butylphenyl)-1-diethoxyphosphoryl-1,1-difluorobut-3-en-2-one |
| SMILES | CCOP(=O)(OCC)C(F)(F)C(=O)/C=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H33F2O4P/c1-9-27-29(26,28-10-2)22(23,24)19(25)12-11-16-13-17(20(3,4)5)15-18(14-16)21(6,7)8/h11-15H,9-10H2,1-8H3/b12-11+ |
| InChIKey | GYYZDKPIXMHGDH-VAWYXSNFSA-N |
| XLogP | 6.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|