C14H19F2O4P — CID 91554178
3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]prop-2-en-1-ol (PubChem CID 91554178) has the molecular formula C14H19F2O4P and a molecular weight of 320.27 g/mol. Its IUPAC name is 3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]prop-2-en-1-ol.
| Compound Name | 3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 91554178 |
| Molecular Formula | C14H19F2O4P |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]prop-2-en-1-ol |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1ccc(C=CCO)cc1 |
| InChI | InChI=1S/C14H19F2O4P/c1-3-19-21(18,20-4-2)14(15,16)13-9-7-12(8-10-13)6-5-11-17/h5-10,17H,3-4,11H2,1-2H3 |
| InChIKey | HPHYQFOQJKWOEF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|