C14H18F3O4P — CID 54304124
[2-(2-diethoxyphosphorylethenyl)-5-(trifluoromethyl)phenyl]methanol (PubChem CID 54304124) has the molecular formula C14H18F3O4P and a molecular weight of 338.26 g/mol. Its IUPAC name is [2-(2-diethoxyphosphorylethenyl)-5-(trifluoromethyl)phenyl]methanol.
| Compound Name | [2-(2-diethoxyphosphorylethenyl)-5-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 54304124 |
| Molecular Formula | C14H18F3O4P |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | [2-(2-diethoxyphosphorylethenyl)-5-(trifluoromethyl)phenyl]methanol |
| SMILES | CCOP(=O)(C=Cc1ccc(C(F)(F)F)cc1CO)OCC |
| InChI | InChI=1S/C14H18F3O4P/c1-3-20-22(19,21-4-2)8-7-11-5-6-13(14(15,16)17)9-12(11)10-18/h5-9,18H,3-4,10H2,1-2H3 |
| InChIKey | SGHIBBBUKFHLLR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|