C11H10BrF3O — CID 169476264
[2-(3-bromoprop-1-enyl)-5-(trifluoromethyl)phenyl]methanol (PubChem CID 169476264) has the molecular formula C11H10BrF3O and a molecular weight of 295.10 g/mol. Its IUPAC name is [2-(3-bromoprop-1-enyl)-5-(trifluoromethyl)phenyl]methanol.
| Compound Name | [2-(3-bromoprop-1-enyl)-5-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 169476264 |
| Molecular Formula | C11H10BrF3O |
| Molecular Weight | 295.10 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | [2-(3-bromoprop-1-enyl)-5-(trifluoromethyl)phenyl]methanol |
| SMILES | OCc1cc(C(F)(F)F)ccc1C=CCBr |
| InChI | InChI=1S/C11H10BrF3O/c12-5-1-2-8-3-4-10(11(13,14)15)6-9(8)7-16/h1-4,6,16H,5,7H2 |
| InChIKey | MMZKGCXADUYDLI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.10 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|