C11H11BrF3N — CID 170488006
4-[2-bromo-4-(trifluoromethyl)phenyl]but-3-en-1-amine (PubChem CID 170488006) has the molecular formula C11H11BrF3N and a molecular weight of 294.11 g/mol. Its IUPAC name is 4-[2-bromo-4-(trifluoromethyl)phenyl]but-3-en-1-amine.
| Compound Name | 4-[2-bromo-4-(trifluoromethyl)phenyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 170488006 |
| Molecular Formula | C11H11BrF3N |
| Molecular Weight | 294.11 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 4-[2-bromo-4-(trifluoromethyl)phenyl]but-3-en-1-amine |
| SMILES | NCCC=Cc1ccc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C11H11BrF3N/c12-10-7-9(11(13,14)15)5-4-8(10)3-1-2-6-16/h1,3-5,7H,2,6,16H2 |
| InChIKey | LEZURZOUSJRMTP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.11 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |