C11H12F3NO — CID 117333674
(E)-3-[2-methoxy-4-(trifluoromethyl)phenyl]prop-2-en-1-amine (PubChem CID 117333674) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is (E)-3-[2-methoxy-4-(trifluoromethyl)phenyl]prop-2-en-1-amine.
| Compound Name | (E)-3-[2-methoxy-4-(trifluoromethyl)phenyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 117333674 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (E)-3-[2-methoxy-4-(trifluoromethyl)phenyl]prop-2-en-1-amine |
| SMILES | COc1cc(C(F)(F)F)ccc1/C=C/CN |
| InChI | InChI=1S/C11H12F3NO/c1-16-10-7-9(11(12,13)14)5-4-8(10)3-2-6-15/h2-5,7H,6,15H2,1H3/b3-2+ |
| InChIKey | LOTTUJDYAHKXLN-NSCUHMNNSA-N |
| XLogP | 2.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |