C10H12FNO2 — CID 117286690
5-[(E)-3-aminoprop-1-enyl]-2-fluoro-4-methoxyphenol (PubChem CID 117286690) has the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. Its IUPAC name is 5-[(E)-3-aminoprop-1-enyl]-2-fluoro-4-methoxyphenol.
| Compound Name | 5-[(E)-3-aminoprop-1-enyl]-2-fluoro-4-methoxyphenol |
|---|---|
| PubChem CID | 117286690 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 5-[(E)-3-aminoprop-1-enyl]-2-fluoro-4-methoxyphenol |
| SMILES | COc1cc(F)c(O)cc1/C=C/CN |
| InChI | InChI=1S/C10H12FNO2/c1-14-10-6-8(11)9(13)5-7(10)3-2-4-12/h2-3,5-6,13H,4,12H2,1H3/b3-2+ |
| InChIKey | LESAMOFHCVRPIS-NSCUHMNNSA-N |
| XLogP | 1.51 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |