C11H13F2NO2 — CID 117330030
(E)-3-(2,6-difluoro-3,5-dimethoxyphenyl)prop-2-en-1-amine (PubChem CID 117330030) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is (E)-3-(2,6-difluoro-3,5-dimethoxyphenyl)prop-2-en-1-amine.
| Compound Name | (E)-3-(2,6-difluoro-3,5-dimethoxyphenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 117330030 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | (E)-3-(2,6-difluoro-3,5-dimethoxyphenyl)prop-2-en-1-amine |
| SMILES | COc1cc(OC)c(F)c(/C=C/CN)c1F |
| InChI | InChI=1S/C11H13F2NO2/c1-15-8-6-9(16-2)11(13)7(10(8)12)4-3-5-14/h3-4,6H,5,14H2,1-2H3/b4-3+ |
| InChIKey | VRDYVASWBGYXOY-ONEGZZNKSA-N |
| XLogP | 1.95 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |