C10H9BrF2O — CID 169475772
1-(3-bromoprop-1-enyl)-4,5-difluoro-2-methoxybenzene (PubChem CID 169475772) has the molecular formula C10H9BrF2O and a molecular weight of 263.08 g/mol. Its IUPAC name is 1-(3-bromoprop-1-enyl)-4,5-difluoro-2-methoxybenzene.
| Compound Name | 1-(3-bromoprop-1-enyl)-4,5-difluoro-2-methoxybenzene |
|---|---|
| PubChem CID | 169475772 |
| Molecular Formula | C10H9BrF2O |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 1-(3-bromoprop-1-enyl)-4,5-difluoro-2-methoxybenzene |
| SMILES | COc1cc(F)c(F)cc1C=CCBr |
| InChI | InChI=1S/C10H9BrF2O/c1-14-10-6-9(13)8(12)5-7(10)3-2-4-11/h2-3,5-6H,4H2,1H3 |
| InChIKey | PBUVBKBJKYMYHH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|