C9H7BrF2O — CID 169475416
2-(3-bromoprop-1-enyl)-4,5-difluorophenol (PubChem CID 169475416) has the molecular formula C9H7BrF2O and a molecular weight of 249.05 g/mol. Its IUPAC name is 2-(3-bromoprop-1-enyl)-4,5-difluorophenol.
| Compound Name | 2-(3-bromoprop-1-enyl)-4,5-difluorophenol |
|---|---|
| PubChem CID | 169475416 |
| Molecular Formula | C9H7BrF2O |
| Molecular Weight | 249.05 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 2-(3-bromoprop-1-enyl)-4,5-difluorophenol |
| SMILES | Oc1cc(F)c(F)cc1C=CCBr |
| InChI | InChI=1S/C9H7BrF2O/c10-3-1-2-6-4-7(11)8(12)5-9(6)13/h1-2,4-5,13H,3H2 |
| InChIKey | XBBPPGWZZHNPNF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.05 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|