C9H7BrF2 — CID 4997890
4-(3-bromoprop-1-enyl)-1,2-difluorobenzene (PubChem CID 4997890) has the molecular formula C9H7BrF2 and a molecular weight of 233.06 g/mol. Its IUPAC name is 4-(3-bromoprop-1-enyl)-1,2-difluorobenzene.
| Compound Name | 4-(3-bromoprop-1-enyl)-1,2-difluorobenzene |
|---|---|
| PubChem CID | 4997890 |
| Molecular Formula | C9H7BrF2 |
| Molecular Weight | 233.06 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 4-(3-bromoprop-1-enyl)-1,2-difluorobenzene |
| SMILES | Fc1ccc(C=CCBr)cc1F |
| InChI | InChI=1S/C9H7BrF2/c10-5-1-2-7-3-4-8(11)9(12)6-7/h1-4,6H,5H2 |
| InChIKey | YDOLYRGUEPNXJD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.06 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|