C9H6BrF3 — CID 169475296
2-(3-bromoprop-1-enyl)-1,3,4-trifluorobenzene (PubChem CID 169475296) has the molecular formula C9H6BrF3 and a molecular weight of 251.04 g/mol. Its IUPAC name is 2-(3-bromoprop-1-enyl)-1,3,4-trifluorobenzene.
| Compound Name | 2-(3-bromoprop-1-enyl)-1,3,4-trifluorobenzene |
|---|---|
| PubChem CID | 169475296 |
| Molecular Formula | C9H6BrF3 |
| Molecular Weight | 251.04 g/mol |
| Exact Mass | 249.96 |
| IUPAC Name | 2-(3-bromoprop-1-enyl)-1,3,4-trifluorobenzene |
| SMILES | Fc1ccc(F)c(C=CCBr)c1F |
| InChI | InChI=1S/C9H6BrF3/c10-5-1-2-6-7(11)3-4-8(12)9(6)13/h1-4H,5H2 |
| InChIKey | TVZJMZBWXLXFIW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.04 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|