About 3-(3-amino-2,6-difluorophenyl)prop-2-en-1-ol
3-(3-amino-2,6-difluorophenyl)prop-2-en-1-ol (PubChem CID 169453360) has the molecular formula C9H9F2NO
and a molecular weight of 185.17 g/mol. Its IUPAC name is 3-(3-amino-2,6-difluorophenyl)prop-2-en-1-ol.
Molecular Properties
| Compound Name | 3-(3-amino-2,6-difluorophenyl)prop-2-en-1-ol |
| PubChem CID | 169453360 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 3-(3-amino-2,6-difluorophenyl)prop-2-en-1-ol |
| SMILES | Nc1ccc(F)c(C=CCO)c1F |
| InChI | InChI=1S/C9H9F2NO/c10-7-3-4-8(12)9(11)6(7)2-1-5-13/h1-4,13H,5,12H2 |
| InChIKey | PKMZPKUTMNBFDW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-amino-2,6-difluorophenyl)prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-amino-2,6-difluorophenyl)prop-2-en-1-ol?
The IUPAC name of 3-(3-amino-2,6-difluorophenyl)prop-2-en-1-ol (CID 169453360) is 3-(3-amino-2,6-difluorophenyl)prop-2-en-1-ol.
What is the SMILES notation for 3-(3-amino-2,6-difluorophenyl)prop-2-en-1-ol?
The canonical SMILES for 3-(3-amino-2,6-difluorophenyl)prop-2-en-1-ol is Nc1ccc(F)c(C=CCO)c1F.
What is the InChIKey of 3-(3-amino-2,6-difluorophenyl)prop-2-en-1-ol?
The InChIKey is PKMZPKUTMNBFDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO/c10-7-3-4-8(12)9(11)6(7)2-1-5-13/h1-4,13H,5,12H2.
What are the key properties of 3-(3-amino-2,6-difluorophenyl)prop-2-en-1-ol?
3-(3-amino-2,6-difluorophenyl)prop-2-en-1-ol has a molecular weight of 185.17 g/mol, XLogP of 1.55, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-amino-2,6-difluorophenyl)prop-2-en-1-ol is sourced from PubChem (CID 169453360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).