C9H9F2NO — CID 169453377
3-(4-amino-3,5-difluorophenyl)prop-2-en-1-ol (PubChem CID 169453377) has the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. Its IUPAC name is 3-(4-amino-3,5-difluorophenyl)prop-2-en-1-ol.
| Compound Name | 3-(4-amino-3,5-difluorophenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 169453377 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 3-(4-amino-3,5-difluorophenyl)prop-2-en-1-ol |
| SMILES | Nc1c(F)cc(C=CCO)cc1F |
| InChI | InChI=1S/C9H9F2NO/c10-7-4-6(2-1-3-13)5-8(11)9(7)12/h1-2,4-5,13H,3,12H2 |
| InChIKey | HCXBOHKXCZNDAE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|