C9H10F2N2 — CID 115111057
5-[(E)-3-aminoprop-1-enyl]-2,3-difluoroaniline (PubChem CID 115111057) has the molecular formula C9H10F2N2 and a molecular weight of 184.19 g/mol. Its IUPAC name is 5-[(E)-3-aminoprop-1-enyl]-2,3-difluoroaniline.
| Compound Name | 5-[(E)-3-aminoprop-1-enyl]-2,3-difluoroaniline |
|---|---|
| PubChem CID | 115111057 |
| Molecular Formula | C9H10F2N2 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 5-[(E)-3-aminoprop-1-enyl]-2,3-difluoroaniline |
| SMILES | NC/C=C/c1cc(N)c(F)c(F)c1 |
| InChI | InChI=1S/C9H10F2N2/c10-7-4-6(2-1-3-12)5-8(13)9(7)11/h1-2,4-5H,3,12-13H2/b2-1+ |
| InChIKey | ZDQKJKSAWVOJOX-OWOJBTEDSA-N |
| XLogP | 1.52 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|