About (E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine
(E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine (PubChem CID 117372631) has the molecular formula C9H8BrF2N
and a molecular weight of 248.07 g/mol. Its IUPAC name is (E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine |
| PubChem CID | 117372631 |
| Molecular Formula | C9H8BrF2N |
| Molecular Weight | 248.07 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | (E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine |
| SMILES | NC/C=C/c1cc(F)c(F)c(Br)c1 |
| InChI | InChI=1S/C9H8BrF2N/c10-7-4-6(2-1-3-13)5-8(11)9(7)12/h1-2,4-5H,3,13H2/b2-1+ |
| InChIKey | NFOMMTBJBUGFMO-OWOJBTEDSA-N |
| XLogP | 2.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.07 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine?
The IUPAC name of (E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine (CID 117372631) is (E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine.
What is the SMILES notation for (E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine?
The canonical SMILES for (E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine is NC/C=C/c1cc(F)c(F)c(Br)c1.
What is the InChIKey of (E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine?
The InChIKey is NFOMMTBJBUGFMO-OWOJBTEDSA-N. The full InChI is InChI=1S/C9H8BrF2N/c10-7-4-6(2-1-3-13)5-8(11)9(7)12/h1-2,4-5H,3,13H2/b2-1+.
What are the key properties of (E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine?
(E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine has a molecular weight of 248.07 g/mol, XLogP of 2.70, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine is sourced from PubChem (CID 117372631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).