C9H8BrF2N — CID 117372631
(E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine (PubChem CID 117372631) has the molecular formula C9H8BrF2N and a molecular weight of 248.07 g/mol. Its IUPAC name is (E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine.
| Compound Name | (E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 117372631 |
| Molecular Formula | C9H8BrF2N |
| Molecular Weight | 248.07 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | (E)-3-(3-bromo-4,5-difluorophenyl)prop-2-en-1-amine |
| SMILES | NC/C=C/c1cc(F)c(F)c(Br)c1 |
| InChI | InChI=1S/C9H8BrF2N/c10-7-4-6(2-1-3-13)5-8(11)9(7)12/h1-2,4-5H,3,13H2/b2-1+ |
| InChIKey | NFOMMTBJBUGFMO-OWOJBTEDSA-N |
| XLogP | 2.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.07 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|