C10H7F2NO — CID 169453655
2,6-difluoro-4-(3-hydroxyprop-1-enyl)benzonitrile (PubChem CID 169453655) has the molecular formula C10H7F2NO and a molecular weight of 195.17 g/mol. Its IUPAC name is 2,6-difluoro-4-(3-hydroxyprop-1-enyl)benzonitrile.
| Compound Name | 2,6-difluoro-4-(3-hydroxyprop-1-enyl)benzonitrile |
|---|---|
| PubChem CID | 169453655 |
| Molecular Formula | C10H7F2NO |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 2,6-difluoro-4-(3-hydroxyprop-1-enyl)benzonitrile |
| SMILES | N#Cc1c(F)cc(C=CCO)cc1F |
| InChI | InChI=1S/C10H7F2NO/c11-9-4-7(2-1-3-14)5-10(12)8(9)6-13/h1-2,4-5,14H,3H2 |
| InChIKey | RUAGADUUQYHKQK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |