About 4-[4-(2,2-difluoroethenyl)-2-fluorophenyl]-2,6-difluorobenzonitrile
4-[4-(2,2-difluoroethenyl)-2-fluorophenyl]-2,6-difluorobenzonitrile (PubChem CID 21138570) has the molecular formula C15H6F5N
and a molecular weight of 295.21 g/mol. Its IUPAC name is 4-[4-(2,2-difluoroethenyl)-2-fluorophenyl]-2,6-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[4-(2,2-difluoroethenyl)-2-fluorophenyl]-2,6-difluorobenzonitrile |
| PubChem CID | 21138570 |
| Molecular Formula | C15H6F5N |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 4-[4-(2,2-difluoroethenyl)-2-fluorophenyl]-2,6-difluorobenzonitrile |
| SMILES | N#Cc1c(F)cc(-c2ccc(C=C(F)F)cc2F)cc1F |
| InChI | InChI=1S/C15H6F5N/c16-12-3-8(4-15(19)20)1-2-10(12)9-5-13(17)11(7-21)14(18)6-9/h1-6H |
| InChIKey | KWHDHJAOGQTFTN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[4-(2,2-difluoroethenyl)-2-fluorophenyl]-2,6-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2,2-difluoroethenyl)-2-fluorophenyl]-2,6-difluorobenzonitrile?
The IUPAC name of 4-[4-(2,2-difluoroethenyl)-2-fluorophenyl]-2,6-difluorobenzonitrile (CID 21138570) is 4-[4-(2,2-difluoroethenyl)-2-fluorophenyl]-2,6-difluorobenzonitrile.
What is the SMILES notation for 4-[4-(2,2-difluoroethenyl)-2-fluorophenyl]-2,6-difluorobenzonitrile?
The canonical SMILES for 4-[4-(2,2-difluoroethenyl)-2-fluorophenyl]-2,6-difluorobenzonitrile is N#Cc1c(F)cc(-c2ccc(C=C(F)F)cc2F)cc1F.
What is the InChIKey of 4-[4-(2,2-difluoroethenyl)-2-fluorophenyl]-2,6-difluorobenzonitrile?
The InChIKey is KWHDHJAOGQTFTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H6F5N/c16-12-3-8(4-15(19)20)1-2-10(12)9-5-13(17)11(7-21)14(18)6-9/h1-6H.
What are the key properties of 4-[4-(2,2-difluoroethenyl)-2-fluorophenyl]-2,6-difluorobenzonitrile?
4-[4-(2,2-difluoroethenyl)-2-fluorophenyl]-2,6-difluorobenzonitrile has a molecular weight of 295.21 g/mol, XLogP of 4.88, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,2-difluoroethenyl)-2-fluorophenyl]-2,6-difluorobenzonitrile is sourced from PubChem (CID 21138570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).