About 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-difluorobenzonitrile
4-[2,4-bis(trifluoromethyl)phenyl]-2,6-difluorobenzonitrile (PubChem CID 134473360) has the molecular formula C15H5F8N
and a molecular weight of 351.20 g/mol. Its IUPAC name is 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-difluorobenzonitrile |
| PubChem CID | 134473360 |
| Molecular Formula | C15H5F8N |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-difluorobenzonitrile |
| SMILES | N#Cc1c(F)cc(-c2ccc(C(F)(F)F)cc2C(F)(F)F)cc1F |
| InChI | InChI=1S/C15H5F8N/c16-12-3-7(4-13(17)10(12)6-24)9-2-1-8(14(18,19)20)5-11(9)15(21,22)23/h1-5H |
| InChIKey | RTIQISGXBXYJHP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-difluorobenzonitrile?
The IUPAC name of 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-difluorobenzonitrile (CID 134473360) is 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-difluorobenzonitrile.
What is the SMILES notation for 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-difluorobenzonitrile?
The canonical SMILES for 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-difluorobenzonitrile is N#Cc1c(F)cc(-c2ccc(C(F)(F)F)cc2C(F)(F)F)cc1F.
What is the InChIKey of 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-difluorobenzonitrile?
The InChIKey is RTIQISGXBXYJHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H5F8N/c16-12-3-7(4-13(17)10(12)6-24)9-2-1-8(14(18,19)20)5-11(9)15(21,22)23/h1-5H.
What are the key properties of 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-difluorobenzonitrile?
4-[2,4-bis(trifluoromethyl)phenyl]-2,6-difluorobenzonitrile has a molecular weight of 351.20 g/mol, XLogP of 5.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,4-bis(trifluoromethyl)phenyl]-2,6-difluorobenzonitrile is sourced from PubChem (CID 134473360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).