C34H16F7NO4 — CID 118185236
3-O-[4-[4-(4-cyano-3,5-difluorophenyl)-3,5-difluorophenyl]-3-fluorophenyl] 1-O-[3-fluoro-4-(4-fluorophenyl)phenyl] propanedioate (PubChem CID 118185236) has the molecular formula C34H16F7NO4 and a molecular weight of 635.49 g/mol. Its IUPAC name is 3-O-[4-[4-(4-cyano-3,5-difluorophenyl)-3,5-difluorophenyl]-3-fluorophenyl] 1-O-[3-fluoro-4-(4-fluorophenyl)phenyl] propanedioate.
| Compound Name | 3-O-[4-[4-(4-cyano-3,5-difluorophenyl)-3,5-difluorophenyl]-3-fluorophenyl] 1-O-[3-fluoro-4-(4-fluorophenyl)phenyl] propanedioate |
|---|---|
| PubChem CID | 118185236 |
| Molecular Formula | C34H16F7NO4 |
| Molecular Weight | 635.49 g/mol |
| Exact Mass | 635.10 |
| IUPAC Name | 3-O-[4-[4-(4-cyano-3,5-difluorophenyl)-3,5-difluorophenyl]-3-fluorophenyl] 1-O-[3-fluoro-4-(4-fluorophenyl)phenyl] propanedioate |
| SMILES | N#Cc1c(F)cc(-c2c(F)cc(-c3ccc(OC(=O)CC(=O)Oc4ccc(-c5ccc(F)cc5)c(F)c4)cc3F)cc2F)cc1F |
| InChI | InChI=1S/C34H16F7NO4/c35-20-3-1-17(2-4-20)23-7-5-21(13-28(23)38)45-32(43)15-33(44)46-22-6-8-24(29(39)14-22)18-9-30(40)34(31(41)10-18)19-11-26(36)25(16-42)27(37)12-19/h1-14H,15H2 |
| InChIKey | SWNMNIFUWACXQK-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.49 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|