C29H16F2N2O4 — CID 149172921
1-O-[4-(4-cyanophenyl)-3-fluorophenyl] 3-O-[3-fluoro-4-(4-isocyanophenyl)phenyl] propanedioate (PubChem CID 149172921) has the molecular formula C29H16F2N2O4 and a molecular weight of 494.45 g/mol. Its IUPAC name is 1-O-[4-(4-cyanophenyl)-3-fluorophenyl] 3-O-[3-fluoro-4-(4-isocyanophenyl)phenyl] propanedioate.
| Compound Name | 1-O-[4-(4-cyanophenyl)-3-fluorophenyl] 3-O-[3-fluoro-4-(4-isocyanophenyl)phenyl] propanedioate |
|---|---|
| PubChem CID | 149172921 |
| Molecular Formula | C29H16F2N2O4 |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 1-O-[4-(4-cyanophenyl)-3-fluorophenyl] 3-O-[3-fluoro-4-(4-isocyanophenyl)phenyl] propanedioate |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(OC(=O)CC(=O)Oc3ccc(-c4ccc(C#N)cc4)c(F)c3)cc2F)cc1 |
| InChI | InChI=1S/C29H16F2N2O4/c1-33-21-8-6-20(7-9-21)25-13-11-23(15-27(25)31)37-29(35)16-28(34)36-22-10-12-24(26(30)14-22)19-4-2-18(17-32)3-5-19/h2-15H,16H2 |
| InChIKey | WZKLFDKOHXDTPT-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|