C34H17F6NO4 — CID 118101625
1-O-[4-[4-(4-cyano-3,5-difluorophenyl)-3,5-difluorophenyl]phenyl] 3-O-[3-fluoro-4-(4-fluorophenyl)phenyl] propanedioate (PubChem CID 118101625) has the molecular formula C34H17F6NO4 and a molecular weight of 617.50 g/mol. Its IUPAC name is 1-O-[4-[4-(4-cyano-3,5-difluorophenyl)-3,5-difluorophenyl]phenyl] 3-O-[3-fluoro-4-(4-fluorophenyl)phenyl] propanedioate.
| Compound Name | 1-O-[4-[4-(4-cyano-3,5-difluorophenyl)-3,5-difluorophenyl]phenyl] 3-O-[3-fluoro-4-(4-fluorophenyl)phenyl] propanedioate |
|---|---|
| PubChem CID | 118101625 |
| Molecular Formula | C34H17F6NO4 |
| Molecular Weight | 617.50 g/mol |
| Exact Mass | 617.11 |
| IUPAC Name | 1-O-[4-[4-(4-cyano-3,5-difluorophenyl)-3,5-difluorophenyl]phenyl] 3-O-[3-fluoro-4-(4-fluorophenyl)phenyl] propanedioate |
| SMILES | N#Cc1c(F)cc(-c2c(F)cc(-c3ccc(OC(=O)CC(=O)Oc4ccc(-c5ccc(F)cc5)c(F)c4)cc3)cc2F)cc1F |
| InChI | InChI=1S/C34H17F6NO4/c35-22-5-1-19(2-6-22)25-10-9-24(15-29(25)38)45-33(43)16-32(42)44-23-7-3-18(4-8-23)20-11-30(39)34(31(40)12-20)21-13-27(36)26(17-41)28(37)14-21/h1-15H,16H2 |
| InChIKey | XRQLDCPNVMCMED-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.50 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|