C28H16ClF2NO4 — CID 123362678
3-O-[4-(4-chlorophenyl)-3-fluorophenyl] 1-O-[4-(4-cyanophenyl)-3-fluorophenyl] propanedioate (PubChem CID 123362678) has the molecular formula C28H16ClF2NO4 and a molecular weight of 503.89 g/mol. Its IUPAC name is 3-O-[4-(4-chlorophenyl)-3-fluorophenyl] 1-O-[4-(4-cyanophenyl)-3-fluorophenyl] propanedioate.
| Compound Name | 3-O-[4-(4-chlorophenyl)-3-fluorophenyl] 1-O-[4-(4-cyanophenyl)-3-fluorophenyl] propanedioate |
|---|---|
| PubChem CID | 123362678 |
| Molecular Formula | C28H16ClF2NO4 |
| Molecular Weight | 503.89 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | 3-O-[4-(4-chlorophenyl)-3-fluorophenyl] 1-O-[4-(4-cyanophenyl)-3-fluorophenyl] propanedioate |
| SMILES | N#Cc1ccc(-c2ccc(OC(=O)CC(=O)Oc3ccc(-c4ccc(Cl)cc4)c(F)c3)cc2F)cc1 |
| InChI | InChI=1S/C28H16ClF2NO4/c29-20-7-5-19(6-8-20)24-12-10-22(14-26(24)31)36-28(34)15-27(33)35-21-9-11-23(25(30)13-21)18-3-1-17(16-32)2-4-18/h1-14H,15H2 |
| InChIKey | MOACCKCRJRYGRR-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.89 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|