C43H33F5N2O4 — CID 122593423
1-O-[4-[4-(4-cyano-3,5-difluorophenyl)-3,5-difluorophenyl]phenyl] 11-O-[4-(4-cyanophenyl)-3-fluorophenyl] undecanedioate (PubChem CID 122593423) has the molecular formula C43H33F5N2O4 and a molecular weight of 736.74 g/mol. Its IUPAC name is 1-O-[4-[4-(4-cyano-3,5-difluorophenyl)-3,5-difluorophenyl]phenyl] 11-O-[4-(4-cyanophenyl)-3-fluorophenyl] undecanedioate.
| Compound Name | 1-O-[4-[4-(4-cyano-3,5-difluorophenyl)-3,5-difluorophenyl]phenyl] 11-O-[4-(4-cyanophenyl)-3-fluorophenyl] undecanedioate |
|---|---|
| PubChem CID | 122593423 |
| Molecular Formula | C43H33F5N2O4 |
| Molecular Weight | 736.74 g/mol |
| Exact Mass | 736.24 |
| IUPAC Name | 1-O-[4-[4-(4-cyano-3,5-difluorophenyl)-3,5-difluorophenyl]phenyl] 11-O-[4-(4-cyanophenyl)-3-fluorophenyl] undecanedioate |
| SMILES | N#Cc1ccc(-c2ccc(OC(=O)CCCCCCCCCC(=O)Oc3ccc(-c4cc(F)c(-c5cc(F)c(C#N)c(F)c5)c(F)c4)cc3)cc2F)cc1 |
| InChI | InChI=1S/C43H33F5N2O4/c44-36-22-31(23-37(45)35(36)26-50)43-39(47)20-30(21-40(43)48)28-14-16-32(17-15-28)53-41(51)8-6-4-2-1-3-5-7-9-42(52)54-33-18-19-34(38(46)24-33)29-12-10-27(25-49)11-13-29/h10-24H,1-9H2 |
| InChIKey | UCVHXYUZTHMHCG-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.74 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|