C35H28F8O4 — CID 90070350
bis[3-fluoro-4-[4-(trifluoromethyl)phenyl]phenyl] nonanedioate (PubChem CID 90070350) has the molecular formula C35H28F8O4 and a molecular weight of 664.59 g/mol. Its IUPAC name is bis[3-fluoro-4-[4-(trifluoromethyl)phenyl]phenyl] nonanedioate.
| Compound Name | bis[3-fluoro-4-[4-(trifluoromethyl)phenyl]phenyl] nonanedioate |
|---|---|
| PubChem CID | 90070350 |
| Molecular Formula | C35H28F8O4 |
| Molecular Weight | 664.59 g/mol |
| Exact Mass | 664.19 |
| IUPAC Name | bis[3-fluoro-4-[4-(trifluoromethyl)phenyl]phenyl] nonanedioate |
| SMILES | O=C(CCCCCCCC(=O)Oc1ccc(-c2ccc(C(F)(F)F)cc2)c(F)c1)Oc1ccc(-c2ccc(C(F)(F)F)cc2)c(F)c1 |
| InChI | InChI=1S/C35H28F8O4/c36-30-20-26(16-18-28(30)22-8-12-24(13-9-22)34(38,39)40)46-32(44)6-4-2-1-3-5-7-33(45)47-27-17-19-29(31(37)21-27)23-10-14-25(15-11-23)35(41,42)43/h8-21H,1-7H2 |
| InChIKey | GGCZGMPWNSMHEH-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.59 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|