About (4-tert-butylphenyl) 5-hydroxypentanoate
(4-tert-butylphenyl) 5-hydroxypentanoate (PubChem CID 585273) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is (4-tert-butylphenyl) 5-hydroxypentanoate.
Molecular Properties
| Compound Name | (4-tert-butylphenyl) 5-hydroxypentanoate |
| PubChem CID | 585273 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (4-tert-butylphenyl) 5-hydroxypentanoate |
| SMILES | CC(C)(C)c1ccc(OC(=O)CCCCO)cc1 |
| InChI | InChI=1S/C15H22O3/c1-15(2,3)12-7-9-13(10-8-12)18-14(17)6-4-5-11-16/h7-10,16H,4-6,11H2,1-3H3 |
| InChIKey | LHWCTVBFTGHSHG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-tert-butylphenyl) 5-hydroxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylphenyl) 5-hydroxypentanoate?
The IUPAC name of (4-tert-butylphenyl) 5-hydroxypentanoate (CID 585273) is (4-tert-butylphenyl) 5-hydroxypentanoate.
What is the SMILES notation for (4-tert-butylphenyl) 5-hydroxypentanoate?
The canonical SMILES for (4-tert-butylphenyl) 5-hydroxypentanoate is CC(C)(C)c1ccc(OC(=O)CCCCO)cc1.
What is the InChIKey of (4-tert-butylphenyl) 5-hydroxypentanoate?
The InChIKey is LHWCTVBFTGHSHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-15(2,3)12-7-9-13(10-8-12)18-14(17)6-4-5-11-16/h7-10,16H,4-6,11H2,1-3H3.
What are the key properties of (4-tert-butylphenyl) 5-hydroxypentanoate?
(4-tert-butylphenyl) 5-hydroxypentanoate has a molecular weight of 250.34 g/mol, XLogP of 3.05, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylphenyl) 5-hydroxypentanoate is sourced from PubChem (CID 585273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).