About [4-(4-methylphenyl)phenyl] 4-hydroxybutanoate
[4-(4-methylphenyl)phenyl] 4-hydroxybutanoate (PubChem CID 139518674) has the molecular formula C17H18O3
and a molecular weight of 270.33 g/mol. Its IUPAC name is [4-(4-methylphenyl)phenyl] 4-hydroxybutanoate.
Molecular Properties
| Compound Name | [4-(4-methylphenyl)phenyl] 4-hydroxybutanoate |
| PubChem CID | 139518674 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [4-(4-methylphenyl)phenyl] 4-hydroxybutanoate |
| SMILES | Cc1ccc(-c2ccc(OC(=O)CCCO)cc2)cc1 |
| InChI | InChI=1S/C17H18O3/c1-13-4-6-14(7-5-13)15-8-10-16(11-9-15)20-17(19)3-2-12-18/h4-11,18H,2-3,12H2,1H3 |
| InChIKey | UAZRPRCJAIAYQI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-methylphenyl)phenyl] 4-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-methylphenyl)phenyl] 4-hydroxybutanoate?
The IUPAC name of [4-(4-methylphenyl)phenyl] 4-hydroxybutanoate (CID 139518674) is [4-(4-methylphenyl)phenyl] 4-hydroxybutanoate.
What is the SMILES notation for [4-(4-methylphenyl)phenyl] 4-hydroxybutanoate?
The canonical SMILES for [4-(4-methylphenyl)phenyl] 4-hydroxybutanoate is Cc1ccc(-c2ccc(OC(=O)CCCO)cc2)cc1.
What is the InChIKey of [4-(4-methylphenyl)phenyl] 4-hydroxybutanoate?
The InChIKey is UAZRPRCJAIAYQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O3/c1-13-4-6-14(7-5-13)15-8-10-16(11-9-15)20-17(19)3-2-12-18/h4-11,18H,2-3,12H2,1H3.
What are the key properties of [4-(4-methylphenyl)phenyl] 4-hydroxybutanoate?
[4-(4-methylphenyl)phenyl] 4-hydroxybutanoate has a molecular weight of 270.33 g/mol, XLogP of 3.34, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-methylphenyl)phenyl] 4-hydroxybutanoate is sourced from PubChem (CID 139518674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).