About 4-hydroxybutyl (4-methylphenyl) carbonate
4-hydroxybutyl (4-methylphenyl) carbonate (PubChem CID 126720991) has the molecular formula C12H16O4
and a molecular weight of 224.26 g/mol. Its IUPAC name is 4-hydroxybutyl (4-methylphenyl) carbonate.
Molecular Properties
| Compound Name | 4-hydroxybutyl (4-methylphenyl) carbonate |
| PubChem CID | 126720991 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 4-hydroxybutyl (4-methylphenyl) carbonate |
| SMILES | Cc1ccc(OC(=O)OCCCCO)cc1 |
| InChI | InChI=1S/C12H16O4/c1-10-4-6-11(7-5-10)16-12(14)15-9-3-2-8-13/h4-7,13H,2-3,8-9H2,1H3 |
| InChIKey | VOLJCSVCTXUPQS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybutyl (4-methylphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybutyl (4-methylphenyl) carbonate?
The IUPAC name of 4-hydroxybutyl (4-methylphenyl) carbonate (CID 126720991) is 4-hydroxybutyl (4-methylphenyl) carbonate.
What is the SMILES notation for 4-hydroxybutyl (4-methylphenyl) carbonate?
The canonical SMILES for 4-hydroxybutyl (4-methylphenyl) carbonate is Cc1ccc(OC(=O)OCCCCO)cc1.
What is the InChIKey of 4-hydroxybutyl (4-methylphenyl) carbonate?
The InChIKey is VOLJCSVCTXUPQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4/c1-10-4-6-11(7-5-10)16-12(14)15-9-3-2-8-13/h4-7,13H,2-3,8-9H2,1H3.
What are the key properties of 4-hydroxybutyl (4-methylphenyl) carbonate?
4-hydroxybutyl (4-methylphenyl) carbonate has a molecular weight of 224.26 g/mol, XLogP of 2.28, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybutyl (4-methylphenyl) carbonate is sourced from PubChem (CID 126720991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).