About methyl acetate;6-(4-methylphenoxy)hexan-1-ol
methyl acetate;6-(4-methylphenoxy)hexan-1-ol (PubChem CID 144725610) has the molecular formula C16H26O4
and a molecular weight of 282.38 g/mol. Its IUPAC name is methyl acetate;6-(4-methylphenoxy)hexan-1-ol.
Molecular Properties
| Compound Name | methyl acetate;6-(4-methylphenoxy)hexan-1-ol |
| PubChem CID | 144725610 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | methyl acetate;6-(4-methylphenoxy)hexan-1-ol |
| SMILES | COC(C)=O.Cc1ccc(OCCCCCCO)cc1 |
| InChI | InChI=1S/C13H20O2.C3H6O2/c1-12-6-8-13(9-7-12)15-11-5-3-2-4-10-14;1-3(4)5-2/h6-9,14H,2-5,10-11H2,1H3;1-2H3 |
| InChIKey | NKCMQMWEOGJBBO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl acetate;6-(4-methylphenoxy)hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl acetate;6-(4-methylphenoxy)hexan-1-ol?
The IUPAC name of methyl acetate;6-(4-methylphenoxy)hexan-1-ol (CID 144725610) is methyl acetate;6-(4-methylphenoxy)hexan-1-ol.
What is the SMILES notation for methyl acetate;6-(4-methylphenoxy)hexan-1-ol?
The canonical SMILES for methyl acetate;6-(4-methylphenoxy)hexan-1-ol is COC(C)=O.Cc1ccc(OCCCCCCO)cc1.
What is the InChIKey of methyl acetate;6-(4-methylphenoxy)hexan-1-ol?
The InChIKey is NKCMQMWEOGJBBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2.C3H6O2/c1-12-6-8-13(9-7-12)15-11-5-3-2-4-10-14;1-3(4)5-2/h6-9,14H,2-5,10-11H2,1H3;1-2H3.
What are the key properties of methyl acetate;6-(4-methylphenoxy)hexan-1-ol?
methyl acetate;6-(4-methylphenoxy)hexan-1-ol has a molecular weight of 282.38 g/mol, XLogP of 3.11, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl acetate;6-(4-methylphenoxy)hexan-1-ol is sourced from PubChem (CID 144725610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).