About [4-[3-hydroxy-5-[4-(3-hydroxypropanoyloxy)phenyl]phenyl]phenyl] 3-hydroxypropanoate
[4-[3-hydroxy-5-[4-(3-hydroxypropanoyloxy)phenyl]phenyl]phenyl] 3-hydroxypropanoate (PubChem CID 86707588) has the molecular formula C24H22O7
and a molecular weight of 422.43 g/mol. Its IUPAC name is [4-[3-hydroxy-5-[4-(3-hydroxypropanoyloxy)phenyl]phenyl]phenyl] 3-hydroxypropanoate.
Molecular Properties
| Compound Name | [4-[3-hydroxy-5-[4-(3-hydroxypropanoyloxy)phenyl]phenyl]phenyl] 3-hydroxypropanoate |
| PubChem CID | 86707588 |
| Molecular Formula | C24H22O7 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | [4-[3-hydroxy-5-[4-(3-hydroxypropanoyloxy)phenyl]phenyl]phenyl] 3-hydroxypropanoate |
| SMILES | O=C(CCO)Oc1ccc(-c2cc(O)cc(-c3ccc(OC(=O)CCO)cc3)c2)cc1 |
| InChI | InChI=1S/C24H22O7/c25-11-9-23(28)30-21-5-1-16(2-6-21)18-13-19(15-20(27)14-18)17-3-7-22(8-4-17)31-24(29)10-12-26/h1-8,13-15,25-27H,9-12H2 |
| InChIKey | PJWTXGYKEUUPRZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-hydroxy-5-[4-(3-hydroxypropanoyloxy)phenyl]phenyl]phenyl] 3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-hydroxy-5-[4-(3-hydroxypropanoyloxy)phenyl]phenyl]phenyl] 3-hydroxypropanoate?
The IUPAC name of [4-[3-hydroxy-5-[4-(3-hydroxypropanoyloxy)phenyl]phenyl]phenyl] 3-hydroxypropanoate (CID 86707588) is [4-[3-hydroxy-5-[4-(3-hydroxypropanoyloxy)phenyl]phenyl]phenyl] 3-hydroxypropanoate.
What is the SMILES notation for [4-[3-hydroxy-5-[4-(3-hydroxypropanoyloxy)phenyl]phenyl]phenyl] 3-hydroxypropanoate?
The canonical SMILES for [4-[3-hydroxy-5-[4-(3-hydroxypropanoyloxy)phenyl]phenyl]phenyl] 3-hydroxypropanoate is O=C(CCO)Oc1ccc(-c2cc(O)cc(-c3ccc(OC(=O)CCO)cc3)c2)cc1.
What is the InChIKey of [4-[3-hydroxy-5-[4-(3-hydroxypropanoyloxy)phenyl]phenyl]phenyl] 3-hydroxypropanoate?
The InChIKey is PJWTXGYKEUUPRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22O7/c25-11-9-23(28)30-21-5-1-16(2-6-21)18-13-19(15-20(27)14-18)17-3-7-22(8-4-17)31-24(29)10-12-26/h1-8,13-15,25-27H,9-12H2.
What are the key properties of [4-[3-hydroxy-5-[4-(3-hydroxypropanoyloxy)phenyl]phenyl]phenyl] 3-hydroxypropanoate?
[4-[3-hydroxy-5-[4-(3-hydroxypropanoyloxy)phenyl]phenyl]phenyl] 3-hydroxypropanoate has a molecular weight of 422.43 g/mol, XLogP of 3.30, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-hydroxy-5-[4-(3-hydroxypropanoyloxy)phenyl]phenyl]phenyl] 3-hydroxypropanoate is sourced from PubChem (CID 86707588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).