C26H18O8 — CID 25157965
[4-[4-(3,5-dihydroxybenzoyl)oxyphenyl]phenyl] 3,5-dihydroxybenzoate (PubChem CID 25157965) has the molecular formula C26H18O8 and a molecular weight of 458.42 g/mol. Its IUPAC name is [4-[4-(3,5-dihydroxybenzoyl)oxyphenyl]phenyl] 3,5-dihydroxybenzoate.
| Compound Name | [4-[4-(3,5-dihydroxybenzoyl)oxyphenyl]phenyl] 3,5-dihydroxybenzoate |
|---|---|
| PubChem CID | 25157965 |
| Molecular Formula | C26H18O8 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | [4-[4-(3,5-dihydroxybenzoyl)oxyphenyl]phenyl] 3,5-dihydroxybenzoate |
| SMILES | O=C(Oc1ccc(-c2ccc(OC(=O)c3cc(O)cc(O)c3)cc2)cc1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C26H18O8/c27-19-9-17(10-20(28)13-19)25(31)33-23-5-1-15(2-6-23)16-3-7-24(8-4-16)34-26(32)18-11-21(29)14-22(30)12-18/h1-14,27-30H |
| InChIKey | SPJJGYDMDYLNPU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|