C50H40O12 — CID 67988204
[4-[2-[4-[1,1-bis[4-(3,5-dihydroxybenzoyl)oxyphenyl]ethyl]phenyl]propan-2-yl]phenyl] 3,5-dihydroxybenzoate (PubChem CID 67988204) has the molecular formula C50H40O12 and a molecular weight of 832.86 g/mol. Its IUPAC name is [4-[2-[4-[1,1-bis[4-(3,5-dihydroxybenzoyl)oxyphenyl]ethyl]phenyl]propan-2-yl]phenyl] 3,5-dihydroxybenzoate.
| Compound Name | [4-[2-[4-[1,1-bis[4-(3,5-dihydroxybenzoyl)oxyphenyl]ethyl]phenyl]propan-2-yl]phenyl] 3,5-dihydroxybenzoate |
|---|---|
| PubChem CID | 67988204 |
| Molecular Formula | C50H40O12 |
| Molecular Weight | 832.86 g/mol |
| Exact Mass | 832.25 |
| IUPAC Name | [4-[2-[4-[1,1-bis[4-(3,5-dihydroxybenzoyl)oxyphenyl]ethyl]phenyl]propan-2-yl]phenyl] 3,5-dihydroxybenzoate |
| SMILES | CC(C)(c1ccc(OC(=O)c2cc(O)cc(O)c2)cc1)c1ccc(C(C)(c2ccc(OC(=O)c3cc(O)cc(O)c3)cc2)c2ccc(OC(=O)c3cc(O)cc(O)c3)cc2)cc1 |
| InChI | InChI=1S/C50H40O12/c1-49(2,33-8-14-43(15-9-33)60-46(57)29-20-37(51)26-38(52)21-29)32-4-6-34(7-5-32)50(3,35-10-16-44(17-11-35)61-47(58)30-22-39(53)27-40(54)23-30)36-12-18-45(19-13-36)62-48(59)31-24-41(55)28-42(56)25-31/h4-28,51-56H,1-3H3 |
| InChIKey | RFXNQFSJUIUTFH-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 200.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.86 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|