C22H18Br2O4 — CID 102279505
[4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl] 3,5-dibromo-4-hydroxybenzoate (PubChem CID 102279505) has the molecular formula C22H18Br2O4 and a molecular weight of 506.19 g/mol. Its IUPAC name is [4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl] 3,5-dibromo-4-hydroxybenzoate.
| Compound Name | [4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl] 3,5-dibromo-4-hydroxybenzoate |
|---|---|
| PubChem CID | 102279505 |
| Molecular Formula | C22H18Br2O4 |
| Molecular Weight | 506.19 g/mol |
| Exact Mass | 503.96 |
| IUPAC Name | [4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl] 3,5-dibromo-4-hydroxybenzoate |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(OC(=O)c2cc(Br)c(O)c(Br)c2)cc1 |
| InChI | InChI=1S/C22H18Br2O4/c1-22(2,14-3-7-16(25)8-4-14)15-5-9-17(10-6-15)28-21(27)13-11-18(23)20(26)19(24)12-13/h3-12,25-26H,1-2H3 |
| InChIKey | DEPSKRQOQDWSQZ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.19 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|