About (4-tert-butylphenyl) 4-tert-butylbenzoate;ethane
(4-tert-butylphenyl) 4-tert-butylbenzoate;ethane (PubChem CID 157202631) has the molecular formula C25H38O2
and a molecular weight of 370.58 g/mol. Its IUPAC name is (4-tert-butylphenyl) 4-tert-butylbenzoate;ethane.
Molecular Properties
| Compound Name | (4-tert-butylphenyl) 4-tert-butylbenzoate;ethane |
| PubChem CID | 157202631 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | (4-tert-butylphenyl) 4-tert-butylbenzoate;ethane |
| SMILES | CC.CC.CC(C)(C)c1ccc(OC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H26O2.2C2H6/c1-20(2,3)16-9-7-15(8-10-16)19(22)23-18-13-11-17(12-14-18)21(4,5)6;2*1-2/h7-14H,1-6H3;2*1-2H3 |
| InChIKey | AQZAQDLNSZNQPV-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-tert-butylphenyl) 4-tert-butylbenzoate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylphenyl) 4-tert-butylbenzoate;ethane?
The IUPAC name of (4-tert-butylphenyl) 4-tert-butylbenzoate;ethane (CID 157202631) is (4-tert-butylphenyl) 4-tert-butylbenzoate;ethane.
What is the SMILES notation for (4-tert-butylphenyl) 4-tert-butylbenzoate;ethane?
The canonical SMILES for (4-tert-butylphenyl) 4-tert-butylbenzoate;ethane is CC.CC.CC(C)(C)c1ccc(OC(=O)c2ccc(C(C)(C)C)cc2)cc1.
What is the InChIKey of (4-tert-butylphenyl) 4-tert-butylbenzoate;ethane?
The InChIKey is AQZAQDLNSZNQPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O2.2C2H6/c1-20(2,3)16-9-7-15(8-10-16)19(22)23-18-13-11-17(12-14-18)21(4,5)6;2*1-2/h7-14H,1-6H3;2*1-2H3.
What are the key properties of (4-tert-butylphenyl) 4-tert-butylbenzoate;ethane?
(4-tert-butylphenyl) 4-tert-butylbenzoate;ethane has a molecular weight of 370.58 g/mol, XLogP of 7.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylphenyl) 4-tert-butylbenzoate;ethane is sourced from PubChem (CID 157202631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).