About bis(3,5-ditert-butylphenyl) 5-hydroxybenzene-1,3-dicarboxylate
bis(3,5-ditert-butylphenyl) 5-hydroxybenzene-1,3-dicarboxylate (PubChem CID 22679071) has the molecular formula C36H46O5
and a molecular weight of 558.76 g/mol. Its IUPAC name is bis(3,5-ditert-butylphenyl) 5-hydroxybenzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | bis(3,5-ditert-butylphenyl) 5-hydroxybenzene-1,3-dicarboxylate |
| PubChem CID | 22679071 |
| Molecular Formula | C36H46O5 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | bis(3,5-ditert-butylphenyl) 5-hydroxybenzene-1,3-dicarboxylate |
| SMILES | CC(C)(C)c1cc(OC(=O)c2cc(O)cc(C(=O)Oc3cc(C(C)(C)C)cc(C(C)(C)C)c3)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H46O5/c1-33(2,3)24-16-25(34(4,5)6)19-29(18-24)40-31(38)22-13-23(15-28(37)14-22)32(39)41-30-20-26(35(7,8)9)17-27(21-30)36(10,11)12/h13-21,37H,1-12H3 |
| InChIKey | VMFZZWYDYUBOSW-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis(3,5-ditert-butylphenyl) 5-hydroxybenzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3,5-ditert-butylphenyl) 5-hydroxybenzene-1,3-dicarboxylate?
The IUPAC name of bis(3,5-ditert-butylphenyl) 5-hydroxybenzene-1,3-dicarboxylate (CID 22679071) is bis(3,5-ditert-butylphenyl) 5-hydroxybenzene-1,3-dicarboxylate.
What is the SMILES notation for bis(3,5-ditert-butylphenyl) 5-hydroxybenzene-1,3-dicarboxylate?
The canonical SMILES for bis(3,5-ditert-butylphenyl) 5-hydroxybenzene-1,3-dicarboxylate is CC(C)(C)c1cc(OC(=O)c2cc(O)cc(C(=O)Oc3cc(C(C)(C)C)cc(C(C)(C)C)c3)c2)cc(C(C)(C)C)c1.
What is the InChIKey of bis(3,5-ditert-butylphenyl) 5-hydroxybenzene-1,3-dicarboxylate?
The InChIKey is VMFZZWYDYUBOSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H46O5/c1-33(2,3)24-16-25(34(4,5)6)19-29(18-24)40-31(38)22-13-23(15-28(37)14-22)32(39)41-30-20-26(35(7,8)9)17-27(21-30)36(10,11)12/h13-21,37H,1-12H3.
What are the key properties of bis(3,5-ditert-butylphenyl) 5-hydroxybenzene-1,3-dicarboxylate?
bis(3,5-ditert-butylphenyl) 5-hydroxybenzene-1,3-dicarboxylate has a molecular weight of 558.76 g/mol, XLogP of 9.02, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3,5-ditert-butylphenyl) 5-hydroxybenzene-1,3-dicarboxylate is sourced from PubChem (CID 22679071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).