C21H32O2 — CID 134438565
(3,5-ditert-butylphenyl) 3,3-dimethyl-2-methylidenebutanoate (PubChem CID 134438565) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (3,5-ditert-butylphenyl) 3,3-dimethyl-2-methylidenebutanoate.
| Compound Name | (3,5-ditert-butylphenyl) 3,3-dimethyl-2-methylidenebutanoate |
|---|---|
| PubChem CID | 134438565 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (3,5-ditert-butylphenyl) 3,3-dimethyl-2-methylidenebutanoate |
| SMILES | C=C(C(=O)Oc1cc(C(C)(C)C)cc(C(C)(C)C)c1)C(C)(C)C |
| InChI | InChI=1S/C21H32O2/c1-14(19(2,3)4)18(22)23-17-12-15(20(5,6)7)11-16(13-17)21(8,9)10/h11-13H,1H2,2-10H3 |
| InChIKey | LSNTZFKDVCFAOH-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|