C16H11F12NO3 — CID 152908096
[3-(2-amino-1,1,1,3,3,3-hexafluoropropan-2-yl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl] 2-methylprop-2-enoate (PubChem CID 152908096) has the molecular formula C16H11F12NO3 and a molecular weight of 493.24 g/mol. Its IUPAC name is [3-(2-amino-1,1,1,3,3,3-hexafluoropropan-2-yl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl] 2-methylprop-2-enoate.
| Compound Name | [3-(2-amino-1,1,1,3,3,3-hexafluoropropan-2-yl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 152908096 |
| Molecular Formula | C16H11F12NO3 |
| Molecular Weight | 493.24 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | [3-(2-amino-1,1,1,3,3,3-hexafluoropropan-2-yl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cc(C(N)(C(F)(F)F)C(F)(F)F)cc(C(O)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11F12NO3/c1-6(2)10(30)32-9-4-7(11(29,13(17,18)19)14(20,21)22)3-8(5-9)12(31,15(23,24)25)16(26,27)28/h3-5,31H,1,29H2,2H3 |
| InChIKey | UGQMQKGGWOXIAD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.24 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|