C14H10F6O4 — CID 88579230
[2-[3,5-bis(trifluoromethyl)phenoxy]-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 88579230) has the molecular formula C14H10F6O4 and a molecular weight of 356.22 g/mol. Its IUPAC name is [2-[3,5-bis(trifluoromethyl)phenoxy]-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[3,5-bis(trifluoromethyl)phenoxy]-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88579230 |
| Molecular Formula | C14H10F6O4 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | [2-[3,5-bis(trifluoromethyl)phenoxy]-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10F6O4/c1-7(2)12(22)23-6-11(21)24-10-4-8(13(15,16)17)3-9(5-10)14(18,19)20/h3-5H,1,6H2,2H3 |
| InChIKey | OZSMOTDJZBZRSS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|