C28H28O11 — CID 118198272
[2-[4-[2,2-dimethoxy-2-[4-[2-(2-methylprop-2-enoyloxy)acetyl]oxyphenyl]acetyl]phenoxy]-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 118198272) has the molecular formula C28H28O11 and a molecular weight of 540.52 g/mol. Its IUPAC name is [2-[4-[2,2-dimethoxy-2-[4-[2-(2-methylprop-2-enoyloxy)acetyl]oxyphenyl]acetyl]phenoxy]-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[4-[2,2-dimethoxy-2-[4-[2-(2-methylprop-2-enoyloxy)acetyl]oxyphenyl]acetyl]phenoxy]-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118198272 |
| Molecular Formula | C28H28O11 |
| Molecular Weight | 540.52 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | [2-[4-[2,2-dimethoxy-2-[4-[2-(2-methylprop-2-enoyloxy)acetyl]oxyphenyl]acetyl]phenoxy]-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)Oc1ccc(C(=O)C(OC)(OC)c2ccc(OC(=O)COC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C28H28O11/c1-17(2)26(32)36-15-23(29)38-21-11-7-19(8-12-21)25(31)28(34-5,35-6)20-9-13-22(14-10-20)39-24(30)16-37-27(33)18(3)4/h7-14H,1,3,15-16H2,2,4-6H3 |
| InChIKey | UBLREWNESUBGKS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|