C24H32O9 — CID 154612738
1,2-bis[4-[3-hydroxy-2-(hydroxymethyl)propoxy]phenyl]-2,2-dimethoxyethanone (PubChem CID 154612738) has the molecular formula C24H32O9 and a molecular weight of 464.51 g/mol. Its IUPAC name is 1,2-bis[4-[3-hydroxy-2-(hydroxymethyl)propoxy]phenyl]-2,2-dimethoxyethanone.
| Compound Name | 1,2-bis[4-[3-hydroxy-2-(hydroxymethyl)propoxy]phenyl]-2,2-dimethoxyethanone |
|---|---|
| PubChem CID | 154612738 |
| Molecular Formula | C24H32O9 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 1,2-bis[4-[3-hydroxy-2-(hydroxymethyl)propoxy]phenyl]-2,2-dimethoxyethanone |
| SMILES | COC(OC)(C(=O)c1ccc(OCC(CO)CO)cc1)c1ccc(OCC(CO)CO)cc1 |
| InChI | InChI=1S/C24H32O9/c1-30-24(31-2,20-5-9-22(10-6-20)33-16-18(13-27)14-28)23(29)19-3-7-21(8-4-19)32-15-17(11-25)12-26/h3-10,17-18,25-28H,11-16H2,1-2H3 |
| InChIKey | VPTCMXZISURHNR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|