C18H20O3S — CID 54425138
2,2-dimethoxy-2-(4-methylphenyl)-1-(4-methylsulfanylphenyl)ethanone (PubChem CID 54425138) has the molecular formula C18H20O3S and a molecular weight of 316.42 g/mol. Its IUPAC name is 2,2-dimethoxy-2-(4-methylphenyl)-1-(4-methylsulfanylphenyl)ethanone.
| Compound Name | 2,2-dimethoxy-2-(4-methylphenyl)-1-(4-methylsulfanylphenyl)ethanone |
|---|---|
| PubChem CID | 54425138 |
| Molecular Formula | C18H20O3S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2,2-dimethoxy-2-(4-methylphenyl)-1-(4-methylsulfanylphenyl)ethanone |
| SMILES | COC(OC)(C(=O)c1ccc(SC)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H20O3S/c1-13-5-9-15(10-6-13)18(20-2,21-3)17(19)14-7-11-16(22-4)12-8-14/h5-12H,1-4H3 |
| InChIKey | OUYFFGVNUCNMNT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|