C29H27O4S+ — CID 153448773
[4-[1,1-dimethoxy-2-(4-methoxyphenyl)-2-oxoethyl]phenyl]-diphenylsulfanium (PubChem CID 153448773) has the molecular formula C29H27O4S+ and a molecular weight of 471.60 g/mol. Its IUPAC name is [4-[1,1-dimethoxy-2-(4-methoxyphenyl)-2-oxoethyl]phenyl]-diphenylsulfanium.
| Compound Name | [4-[1,1-dimethoxy-2-(4-methoxyphenyl)-2-oxoethyl]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 153448773 |
| Molecular Formula | C29H27O4S+ |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | [4-[1,1-dimethoxy-2-(4-methoxyphenyl)-2-oxoethyl]phenyl]-diphenylsulfanium |
| SMILES | COc1ccc(C(=O)C(OC)(OC)c2ccc([S+](c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H27O4S/c1-31-24-18-14-22(15-19-24)28(30)29(32-2,33-3)23-16-20-27(21-17-23)34(25-10-6-4-7-11-25)26-12-8-5-9-13-26/h4-21H,1-3H3/q+1 |
| InChIKey | PUIYPRUTHLEZCM-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|