C33H30O7 — CID 174419072
1-[4-[4-(2,2-dimethoxy-2-phenylacetyl)benzoyl]phenyl]-2,2-dimethoxy-2-phenylethanone (PubChem CID 174419072) has the molecular formula C33H30O7 and a molecular weight of 538.60 g/mol. Its IUPAC name is 1-[4-[4-(2,2-dimethoxy-2-phenylacetyl)benzoyl]phenyl]-2,2-dimethoxy-2-phenylethanone.
| Compound Name | 1-[4-[4-(2,2-dimethoxy-2-phenylacetyl)benzoyl]phenyl]-2,2-dimethoxy-2-phenylethanone |
|---|---|
| PubChem CID | 174419072 |
| Molecular Formula | C33H30O7 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 1-[4-[4-(2,2-dimethoxy-2-phenylacetyl)benzoyl]phenyl]-2,2-dimethoxy-2-phenylethanone |
| SMILES | COC(OC)(C(=O)c1ccc(C(=O)c2ccc(C(=O)C(OC)(OC)c3ccccc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H30O7/c1-37-32(38-2,27-11-7-5-8-12-27)30(35)25-19-15-23(16-20-25)29(34)24-17-21-26(22-18-24)31(36)33(39-3,40-4)28-13-9-6-10-14-28/h5-22H,1-4H3 |
| InChIKey | GVZHREFXTMNFKQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|