C20H24O3 — CID 15697899
1-(3-tert-butylphenyl)-2,2-dimethoxy-2-phenylethanone (PubChem CID 15697899) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-(3-tert-butylphenyl)-2,2-dimethoxy-2-phenylethanone.
| Compound Name | 1-(3-tert-butylphenyl)-2,2-dimethoxy-2-phenylethanone |
|---|---|
| PubChem CID | 15697899 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-(3-tert-butylphenyl)-2,2-dimethoxy-2-phenylethanone |
| SMILES | COC(OC)(C(=O)c1cccc(C(C)(C)C)c1)c1ccccc1 |
| InChI | InChI=1S/C20H24O3/c1-19(2,3)17-13-9-10-15(14-17)18(21)20(22-4,23-5)16-11-7-6-8-12-16/h6-14H,1-5H3 |
| InChIKey | JQYPXTBQDRSOFQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|