C19H20O6 — CID 88598506
2-methoxy-2-methylperoxy-1,2-diphenylethanone;prop-2-enoic acid (PubChem CID 88598506) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is 2-methoxy-2-methylperoxy-1,2-diphenylethanone;prop-2-enoic acid.
| Compound Name | 2-methoxy-2-methylperoxy-1,2-diphenylethanone;prop-2-enoic acid |
|---|---|
| PubChem CID | 88598506 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-methoxy-2-methylperoxy-1,2-diphenylethanone;prop-2-enoic acid |
| SMILES | C=CC(=O)O.COOC(OC)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16O4.C3H4O2/c1-18-16(20-19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13;1-2-3(4)5/h3-12H,1-2H3;2H,1H2,(H,4,5) |
| InChIKey | IOLCSQNRCCIMDP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|