C22H28O3 — CID 19035365
2,2-di(butan-2-yloxy)-1,2-diphenylethanone (PubChem CID 19035365) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is 2,2-di(butan-2-yloxy)-1,2-diphenylethanone.
| Compound Name | 2,2-di(butan-2-yloxy)-1,2-diphenylethanone |
|---|---|
| PubChem CID | 19035365 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 2,2-di(butan-2-yloxy)-1,2-diphenylethanone |
| SMILES | CCC(C)OC(OC(C)CC)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28O3/c1-5-17(3)24-22(25-18(4)6-2,20-15-11-8-12-16-20)21(23)19-13-9-7-10-14-19/h7-18H,5-6H2,1-4H3 |
| InChIKey | SSHNNYCRQZIZBQ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|