C23H19FO2 — CID 175526561
2-(1-fluoroethyl)-1,2,3-triphenylpropane-1,3-dione (PubChem CID 175526561) has the molecular formula C23H19FO2 and a molecular weight of 346.40 g/mol. Its IUPAC name is 2-(1-fluoroethyl)-1,2,3-triphenylpropane-1,3-dione.
| Compound Name | 2-(1-fluoroethyl)-1,2,3-triphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 175526561 |
| Molecular Formula | C23H19FO2 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-(1-fluoroethyl)-1,2,3-triphenylpropane-1,3-dione |
| SMILES | CC(F)C(C(=O)c1ccccc1)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19FO2/c1-17(24)23(20-15-9-4-10-16-20,21(25)18-11-5-2-6-12-18)22(26)19-13-7-3-8-14-19/h2-17H,1H3 |
| InChIKey | YSYKFVNZYOBRHC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|