About potassium;sodium;2-phenyl-2-propan-2-ylpropanedioate
potassium;sodium;2-phenyl-2-propan-2-ylpropanedioate (PubChem CID 139411731) has the molecular formula C12H12KNaO4
and a molecular weight of 282.31 g/mol. Its IUPAC name is potassium;sodium;2-phenyl-2-propan-2-ylpropanedioate.
Molecular Properties
| Compound Name | potassium;sodium;2-phenyl-2-propan-2-ylpropanedioate |
| PubChem CID | 139411731 |
| Molecular Formula | C12H12KNaO4 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | potassium;sodium;2-phenyl-2-propan-2-ylpropanedioate |
| SMILES | CC(C)C(C(=O)[O-])(C(=O)[O-])c1ccccc1.[K+].[Na+] |
| InChI | InChI=1S/C12H14O4.K.Na/c1-8(2)12(10(13)14,11(15)16)9-6-4-3-5-7-9;;/h3-8H,1-2H3,(H,13,14)(H,15,16);;/q;2*+1/p-2 |
| InChIKey | LQINTYFVGGTSHV-UHFFFAOYSA-L |
| XLogP | -6.91 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | -6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze potassium;sodium;2-phenyl-2-propan-2-ylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;sodium;2-phenyl-2-propan-2-ylpropanedioate?
The IUPAC name of potassium;sodium;2-phenyl-2-propan-2-ylpropanedioate (CID 139411731) is potassium;sodium;2-phenyl-2-propan-2-ylpropanedioate.
What is the SMILES notation for potassium;sodium;2-phenyl-2-propan-2-ylpropanedioate?
The canonical SMILES for potassium;sodium;2-phenyl-2-propan-2-ylpropanedioate is CC(C)C(C(=O)[O-])(C(=O)[O-])c1ccccc1.[K+].[Na+].
What is the InChIKey of potassium;sodium;2-phenyl-2-propan-2-ylpropanedioate?
The InChIKey is LQINTYFVGGTSHV-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H14O4.K.Na/c1-8(2)12(10(13)14,11(15)16)9-6-4-3-5-7-9;;/h3-8H,1-2H3,(H,13,14)(H,15,16);;/q;2*+1/p-2.
What are the key properties of potassium;sodium;2-phenyl-2-propan-2-ylpropanedioate?
potassium;sodium;2-phenyl-2-propan-2-ylpropanedioate has a molecular weight of 282.31 g/mol, XLogP of -6.91, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;sodium;2-phenyl-2-propan-2-ylpropanedioate is sourced from PubChem (CID 139411731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).